Information card for entry 2005801
| Chemical name |
Methyl (1R,2R)-1-cyano-2-[(S)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclopropane- 1-carboxylate |
| Formula |
C11 H15 N O4 |
| Calculated formula |
C11 H15 N O4 |
| SMILES |
O=C(OC)[C@]1([C@@H](C1)[C@@H]1OC(OC1)(C)C)C#N |
| Title of publication |
Methyl (1<i>R</i>,2<i>R</i>)- and (1<i>S</i>,2<i>S</i>)-1-Cyano-2-[(<i>S</i>)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclopropane-1-carboxylate |
| Authors of publication |
Cativiela, C.; Díaz-de-Villegas, M. D.; Gálvez, J. A.; Jiménez, A. I.; López, M. P. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1996 |
| Journal volume |
52 |
| Journal issue |
12 |
| Pages of publication |
3210 - 3213 |
| a |
22.37 ± 0.003 Å |
| b |
5.692 ± 0.001 Å |
| c |
9.39 ± 0.002 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1195.6 ± 0.4 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0496 |
| Residual factor for significantly intense reflections |
0.0424 |
| Weighted residual factors for all reflections |
0.1156 |
| Weighted residual factors for significantly intense reflections |
0.1083 |
| Goodness-of-fit parameter for all reflections |
1.036 |
| Goodness-of-fit parameter for significantly intense reflections |
1.046 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2005801.html