Information card for entry 2007744
| Chemical name |
1,2,3,4,5,6,7,8,9,10-decahydro-3,3,6,6-tetramethyl-1,8-dioxo-10- vinylacridin-9-yl-methyl acetate |
| Formula |
C23 H31 N O4 |
| Calculated formula |
C23 H31 N O4 |
| SMILES |
C1C(CC(=O)C2=C1N(C1=C(C2COC(=O)C)C(=O)CC(C1)(C)C)CC=C)(C)C |
| Title of publication |
1,2,3,4,5,6,7,8,9,10-Decahydro-3,3,6,6-tetramethyl-1,8-dioxo-10-vinylacridin-9-ylmethyl Acetate |
| Authors of publication |
R. Sankaranarayanan; D. Velmurugan; P. Murugan; N.Ramasubbu |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1998 |
| Journal volume |
54 |
| Journal issue |
10 |
| Pages of publication |
1534 - 1535 |
| a |
9.747 ± 0.005 Å |
| b |
14.882 ± 0.004 Å |
| c |
15.48 ± 0.005 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2245.4 ± 1.5 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.108 |
| Residual factor for significantly intense reflections |
0.052 |
| Weighted residual factors for all reflections |
0.158 |
| Weighted residual factors for significantly intense reflections |
0.13 |
| Goodness-of-fit parameter for all reflections |
1.089 |
| Goodness-of-fit parameter for significantly intense reflections |
1.175 |
| Diffraction radiation wavelength |
1.5418 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2007744.html