Information card for entry 2008550
| Chemical name |
8b,8c-dibenzoyl-4b-nitro-4b,8b,8c,8d- tetrahydrodibenzo[a,f]cyclopropa[cd]pentalene |
| Formula |
C30 H19 N O4 |
| Calculated formula |
C30 H19 N O4 |
| SMILES |
O=N(=O)[C@]12c3ccccc3[C@@H]3[C@](c4c1cccc4)([C@]23C(=O)c1ccccc1)C(=O)c1ccccc1.O=N(=O)[C@@]12c3ccccc3[C@H]3[C@@](c4c1cccc4)([C@@]23C(=O)c1ccccc1)C(=O)c1ccccc1 |
| Title of publication |
Regioselectivity in dibenzobarrelene photorearrangements: photoproducts derived from 9-substituted-dibenzobarrelenes |
| Authors of publication |
Muneer, M.; Ramaiah, D.; Ajitkumar, E. S.; Sajimon, M. C.; Rath, Nigam P.; George, M. V. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1999 |
| Journal volume |
55 |
| Journal issue |
6 |
| Pages of publication |
996 - 1000 |
| a |
16.8684 ± 0.0001 Å |
| b |
15.3955 ± 0.0001 Å |
| c |
17.52 ± 0.0002 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
4549.9 ± 0.07 Å3 |
| Cell temperature |
223 ± 2 K |
| Ambient diffraction temperature |
223 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.061 |
| Residual factor for significantly intense reflections |
0.045 |
| Weighted residual factors for all reflections included in the refinement |
0.11 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.056 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2008550.html