Information card for entry 2009507
| Formula |
C14 H21 Cl9 N6 O P6 |
| Calculated formula |
C14 H20 Cl9 N6 O P6 |
| SMILES |
P1(P2(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N2)(Oc2c(cccc2C(C)(C)C)C(C)(C)C)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1 |
| Title of publication |
2-(2,6-Di-<i>tert</i>-butylphenoxy)-2',4,4,4',4',6,6,6',6'-nonachloro-2,2'-bi(cyclotri-λ^5^-phosphazene) |
| Authors of publication |
Hökelek, T.; Kiliç, Z.; Kiliç, A. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1994 |
| Journal volume |
50 |
| Journal issue |
3 |
| Pages of publication |
453 - 456 |
| a |
11.933 ± 0.002 Å |
| b |
16.4 ± 0.003 Å |
| c |
9.471 ± 0.003 Å |
| α |
92.2 ± 0.02° |
| β |
118.15 ± 0.02° |
| γ |
93.85 ± 0.03° |
| Cell volume |
1625.4 ± 0.7 Å3 |
| Cell temperature |
293 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for significantly intense reflections |
0.061 |
| Weighted residual factors for significantly intense reflections |
0.069 |
| Diffraction radiation wavelength |
1.5418 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2009507.html
