Information card for entry 2009671
| Formula |
C20 H24 N2 O |
| Calculated formula |
C20 H24 N2 O |
| SMILES |
N1[C@@H]([C@H](NC(=O)C[C@@H]1c1ccccc1)C(C)C)c1ccccc1.N1[C@H]([C@@H](NC(=O)C[C@H]1c1ccccc1)C(C)C)c1ccccc1 |
| Title of publication |
<i>t</i>-3-Isopropyl-<i>r</i>-2,<i>c</i>-7-diphenylhexahydro-1,4-diazepin-5-one, C~20~H~24~N~2~O |
| Authors of publication |
Ravikumar, K.; Rajan, S.S.; Parthasarathi, V.; Thiruvalluvar, A.; Jeyaraman, R.; Senthilkumar, U.P. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1994 |
| Journal volume |
50 |
| Journal issue |
5 |
| Pages of publication |
827 - 829 |
| a |
5.903 ± 0.002 Å |
| b |
11.143 ± 0.005 Å |
| c |
13.912 ± 0.004 Å |
| α |
77.72 ± 0.03° |
| β |
82.83 ± 0.02° |
| γ |
83.12 ± 0.03° |
| Cell volume |
883 ± 0.6 Å3 |
| Cell temperature |
299 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for significantly intense reflections |
0.059 |
| Weighted residual factors for significantly intense reflections |
0.071 |
| Goodness-of-fit parameter for significantly intense reflections |
1.55 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2009671.html