Information card for entry 2010475
| Formula |
C17 H14 N6 O |
| Calculated formula |
C17 H14 N6 O |
| SMILES |
N1CCN2c3c(ncn3c3ccccc3C=12)c1onc(n1)C1CC1 |
| Title of publication |
The Novel GABA~A~ Receptor Ligand NNC 14-0764: 5-(3-Cyclopropyl-1,2,4-oxadiazol-5-yl)-2,3-dihydrodiimidazo[1,5-<i>a</i>:1',2'-<i>c</i>]quinazoline |
| Authors of publication |
Palmer, R. A.; Janes, R. W.; Corper, A. L.; Lisgarten, J. N.; Hansen, H. C. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1995 |
| Journal volume |
51 |
| Journal issue |
2 |
| Pages of publication |
318 - 322 |
| a |
8.693 ± 0.003 Å |
| b |
26.794 ± 0.007 Å |
| c |
12.534 ± 0.005 Å |
| α |
90° |
| β |
93.08 ± 0.03° |
| γ |
90° |
| Cell volume |
2915.2 ± 1.7 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/a 1 |
| Hall space group symbol |
-P 2yab |
| Residual factor for all reflections |
0.0417 |
| Residual factor for significantly intense reflections |
0.0365 |
| Weighted residual factors for all reflections |
0.1053 |
| Weighted residual factors for significantly intense reflections |
0.1014 |
| Goodness-of-fit parameter for all reflections |
3.951 |
| Goodness-of-fit parameter for significantly intense reflections |
1 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2010475.html