Information card for entry 2010477
| Chemical name |
4-(Diphenylmethylimino-oxy)tetrafluoropyridine |
| Formula |
C18 H10 F4 N2 O |
| Calculated formula |
C18 H10 F4 N2 O |
| SMILES |
Fc1nc(F)c(c(c1F)ON=C(c1ccccc1)c1ccccc1)F |
| Title of publication |
Benzophenone O-4-(2,3,5,6-Tetrafluoro)pyridyloxime, Formed by 4-Substitution of Pentafluoropyridine by Benzophenone Oximate |
| Authors of publication |
Banks, R. E.; Jondi, W. J.; Pritchard, R. G.; Tipping, A. E. |
| Journal of publication |
Acta Crystallographica, Section C: Crystal Structure Communications |
| Year of publication |
1995 |
| Journal volume |
51 |
| Journal issue |
2 |
| Pages of publication |
291 - 293 |
| a |
5.603 ± 0.002 Å |
| b |
23.641 ± 0.004 Å |
| c |
12.643 ± 0.002 Å |
| α |
73.42 ± 0.01° |
| β |
76.34 ± 0.03° |
| γ |
84.92 ± 0.02° |
| Cell volume |
1559 ± 1 Å3 |
| Cell temperature |
286 K |
| Ambient diffraction temperature |
296 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for significantly intense reflections |
0.037 |
| Weighted residual factors for significantly intense reflections |
0.025 |
| Goodness-of-fit parameter for significantly intense reflections |
2.32 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2010477.html
