Information card for entry 2011572
| Chemical name |
1,2,3,4,7,7-hexachlorobicyclo[2.2.1]hept-2-ene-endo-cis-5,6-dicarboxylic acid |
| Formula |
C9 H4 Cl6 O4 |
| Calculated formula |
C9 H4 Cl6 O4 |
| SMILES |
[C@@H]1(C(=O)O)[C@H](C(=O)O)[C@]2(Cl)C(=C(Cl)[C@@]1(Cl)C2(Cl)Cl)Cl |
| Title of publication |
Diels–Alder adducts of maleic anhydride and dienes: new compounds by crystallization |
| Authors of publication |
Bolte, Michael; Degen, Alexander; Egert, Ernst |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2000 |
| Journal volume |
56 |
| Journal issue |
11 |
| Pages of publication |
1338 - 1342 |
| a |
7.499 ± 0.001 Å |
| b |
7.924 ± 0.002 Å |
| c |
11.873 ± 0.002 Å |
| α |
90° |
| β |
101.65 ± 0.01° |
| γ |
90° |
| Cell volume |
691 ± 0.2 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.02 |
| Residual factor for significantly intense reflections |
0.019 |
| Weighted residual factors for all reflections included in the refinement |
0.048 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.044 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2011572.html