Information card for entry 2011677
| Formula |
C21 H40 B7 Cl O Rh2 S |
| Calculated formula |
C21 H40 B7 Cl O Rh2 S |
| SMILES |
[Rh]1234567(C8(C1(C2(C3(C48C)C)C)C)C)[BH]123[BH]489[BH]%10%111[BH]1%124[Rh]4%13%14%15(C%16(C4(C%13(C%14(C%15%16C)C)C)C)C)([BH]4%111([B]63%10[H]4)OC)([BH]9%12S528)Cl7 |
| Title of publication |
[μ-6,9-Cl-8-(OMe)-6,9-(η^5^-C~5~Me~5~)~2~-<i>arachno</i>-6,9,5-Rh~2~SB~7~H~7~] |
| Authors of publication |
Bould, Jonathan; Brownless, Annette; Kilner, Colin; Londesborough, Michael; Štíbr, Bohumil; Kennedy, John D.; Thornton-Pett, Mark |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2001 |
| Journal volume |
57 |
| Journal issue |
1 |
| Pages of publication |
52 - 54 |
| a |
18.1926 ± 0.0002 Å |
| b |
18.1926 ± 0.0002 Å |
| c |
8.4442 ± 0.0001 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2794.78 ± 0.05 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
7 |
| Space group number |
81 |
| Hermann-Mauguin space group symbol |
P -4 |
| Hall space group symbol |
P -4 |
| Residual factor for all reflections |
0.0317 |
| Residual factor for significantly intense reflections |
0.031 |
| Weighted residual factors for all reflections included in the refinement |
0.0799 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.143 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2011677.html