Information card for entry 2011698
| Common name |
Dimethylacetylene dicarboxylate adduct of 1-oxa-4-thia-6-vinyl-spiro[4.5]dec-6-ene |
| Chemical name |
dimethyl 1,2,3,4,4a,7-hexahydronaphthalene-1-spiro-2'-[1,3]oxathiolane-5,6-dicarboxylate |
| Formula |
C16 H20 O5 S |
| Calculated formula |
C16 H20 O5 S |
| SMILES |
S1CCO[C@@]21CCC[C@H]1C2=CCC(=C1C(=O)OC)C(=O)OC.S1CCO[C@]21CCC[C@@H]1C2=CCC(=C1C(=O)OC)C(=O)OC |
| Title of publication |
Some Diels–Alder adducts of 6-vinyl-1-oxa-4-thiaspiro[4.5]dec-6-ene |
| Authors of publication |
Parvez, Masood; Yadav, Veejendra K.; Senthil, Govindaraji |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2001 |
| Journal volume |
57 |
| Journal issue |
1 |
| Pages of publication |
82 - 85 |
| a |
6.812 ± 0.003 Å |
| b |
10.494 ± 0.007 Å |
| c |
11.023 ± 0.005 Å |
| α |
96.014 ± 0.007° |
| β |
90.97 ± 0.01° |
| γ |
90.21 ± 0.02° |
| Cell volume |
783.5 ± 0.7 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.067 |
| Residual factor for significantly intense reflections |
0.054 |
| Weighted residual factors for all reflections included in the refinement |
0.17 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.06 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2011698.html