Information card for entry 2011768
| Chemical name |
Trans-bis(aminopyridine)-bis(O,O'-diisopropyl dithiophosphato-S,S')nickel(II) |
| Formula |
C22 H40 N4 Ni O4 P2 S4 |
| Calculated formula |
C22 H40 N4 Ni O4 P2 S4 |
| SMILES |
c1(cccc[n]1[Ni]12([S]=P(OC(C)C)(OC(C)C)S1)([n]1c(cccc1)N)[S]=P(OC(C)C)(OC(C)C)S2)N |
| Title of publication |
<i>trans</i>-Bis(2-aminopyridine-<i>N</i>)bis(<i>O</i>,<i>O</i>'-diisopropyl dithiophosphato-<i>S</i>,<i>S</i>')nickel(II) |
| Authors of publication |
Hao, Qingli; Jian, Fangfang; Wang, Xin; Razak, Ibrahim Abdul; Shanmuga Sundara Raj, S.; Fun, Hoong-Kun |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2001 |
| Journal volume |
57 |
| Journal issue |
2 |
| Pages of publication |
160 - 161 |
| a |
6.6296 ± 0.0001 Å |
| b |
16.3605 ± 0.0002 Å |
| c |
14.6386 ± 0.0002 Å |
| α |
90° |
| β |
99.938 ± 0.001° |
| γ |
90° |
| Cell volume |
1563.93 ± 0.04 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
7 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.041 |
| Residual factor for significantly intense reflections |
0.035 |
| Weighted residual factors for all reflections included in the refinement |
0.087 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.97 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2011768.html