Information card for entry 2012105
| Common name |
2-[(4-methoxyphenyl)methylidene]-1,4-di-p-tosyl-1,2,3,4-tetrahydroquinoxaline |
| Chemical name |
2-[(4-methoxyphenyl)methylidene]-1,4-di-p-tosyl-1,2,3,4-tetrahydroquinoxaline |
| Formula |
C30 H28 N2 O5 S2 |
| Calculated formula |
C30 H28 N2 O5 S2 |
| SMILES |
S(=O)(=O)(N1c2c(N(S(=O)(=O)c3ccc(cc3)C)C(=C/c3ccc(OC)cc3)/C1)cccc2)c1ccc(cc1)C |
| Title of publication |
A series of three (<i>E</i>)-2-alkylidene-1,4-di-<i>p</i>-tosyl-1,2,3,4-tetrahydroquinoxaline compounds |
| Authors of publication |
Banerjee, Surajit; Mukherjee, Alok K.; Mukhopadhyay, Rupa; Kundu, Nitya G.; Welch, Alan J. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2001 |
| Journal volume |
57 |
| Journal issue |
7 |
| Pages of publication |
861 - 864 |
| a |
10.546 ± 0.001 Å |
| b |
11.844 ± 0.001 Å |
| c |
21.985 ± 0.003 Å |
| α |
90° |
| β |
101.25 ± 0.01° |
| γ |
90° |
| Cell volume |
2693.3 ± 0.5 Å3 |
| Cell temperature |
160 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0661 |
| Residual factor for significantly intense reflections |
0.0422 |
| Weighted residual factors for all reflections included in the refinement |
0.1099 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.017 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2012105.html