Information card for entry 2012186
| Common name |
6-dehydroxyjacareubin |
| Chemical name |
1,5-dihydroxy-2^,^,2^,^-dimethylpyrano-5^,^,6^,^:2,3-xanthone |
| Formula |
C18 H14 O5 |
| Calculated formula |
C18 H14 O5 |
| SMILES |
Oc1cccc2C(=O)c3c(O)c4C=CC(Oc4cc3Oc12)(C)C |
| Title of publication |
6-Deoxyjacareubin |
| Authors of publication |
Doriguetto, Antonio C.; Santos, Marcelo H.; Ellena, Javier A.; Nagem, Tanus J. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2001 |
| Journal volume |
57 |
| Journal issue |
9 |
| Pages of publication |
1095 - 1097 |
| a |
7.445 ± 0.0002 Å |
| b |
9.52 ± 0.0003 Å |
| c |
10.939 ± 0.0003 Å |
| α |
105.051 ± 0.002° |
| β |
103.154 ± 0.002° |
| γ |
93.083 ± 0.002° |
| Cell volume |
723.8 ± 0.04 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0661 |
| Residual factor for significantly intense reflections |
0.0514 |
| Weighted residual factors for all reflections included in the refinement |
0.1502 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.021 |
| Diffraction radiation wavelength |
0.7107 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2012186.html