Information card for entry 2012696
| Common name |
(-)-3-oxo-11α(H)-eudesm-4-en-12-oic acid |
| Chemical name |
(+)-2-(1,2,3,4,4a,5,6,7-Octahydro-4a,8-dimethyl-7-oxo-2- naphthyl)propionic acid |
| Formula |
C15 H22 O3 |
| Calculated formula |
C15 H22 O3 |
| SMILES |
O=C1CC[C@@]2(CC[C@H](CC2=C1C)[C@@H](C(=O)O)C)C |
| Title of publication |
(+)-2-(1,2,3,4,4a,5,6,7-Octahydro-4a,8-dimethyl-7-oxo-2-naphthyl)propionic acid: catemeric hydrogen bonding in a bicyclic sesquiterpenoid keto acid |
| Authors of publication |
Brunskill, Andrew P. J.; Thompson, Hugh W.; Lalancette, Roger A. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2002 |
| Journal volume |
58 |
| Journal issue |
5 |
| Pages of publication |
o251 - o253 |
| a |
10.0225 ± 0.0014 Å |
| b |
14.862 ± 0.002 Å |
| c |
10.0873 ± 0.0014 Å |
| α |
90° |
| β |
110.758 ± 0.011° |
| γ |
90° |
| Cell volume |
1405 ± 0.4 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.061 |
| Residual factor for significantly intense reflections |
0.042 |
| Weighted residual factors for significantly intense reflections |
0.096 |
| Weighted residual factors for all reflections included in the refinement |
0.105 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.03 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2012696.html