Information card for entry 2013152
| Common name |
1,2,4,5-tetrakis(2'-vinylpyridyl)benzene-dichloromethane (1:2) |
| Chemical name |
1,2,4,5-tetrakis(2'-vinylpyridyl)benzene-dichloromethane (1:2) |
| Formula |
C36 H30 Cl4 N4 |
| Calculated formula |
C36 H30 Cl4 N4 |
| SMILES |
c1ccc(nc1)/C=C/c1cc(/C=C/c2ccccn2)c(cc1/C=C/c1ccccn1)/C=C/c1ccccn1.ClCCl.ClCCl |
| Title of publication |
1,2,4,5-Tetrakis(2-vinylpyridyl)benzene–dichloromethane (1/2) |
| Authors of publication |
Holmes, Brian T.; Padgett, Clifford W.; Pennington, William T. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2003 |
| Journal volume |
59 |
| Journal issue |
3 |
| Pages of publication |
o114 - o116 |
| a |
8.928 ± 0.002 Å |
| b |
18.596 ± 0.004 Å |
| c |
10.015 ± 0.002 Å |
| α |
90° |
| β |
99.822 ± 0.006° |
| γ |
90° |
| Cell volume |
1638.4 ± 0.6 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1096 |
| Residual factor for significantly intense reflections |
0.0653 |
| Weighted residual factors for significantly intense reflections |
0.1187 |
| Weighted residual factors for all reflections included in the refinement |
0.1369 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.987 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2013152.html