Information card for entry 2013491
| Chemical name |
cis,cis,cis-1,2,4,5-cyclohexanetetracarboxylic acid |
| Formula |
C10 H12 O8 |
| Calculated formula |
C10 H12 O8 |
| SMILES |
OC(=O)[C@@H]1C[C@H](C(=O)O)[C@@H](C[C@@H]1C(=O)O)C(=O)O |
| Title of publication |
<i>cis</i>,<i>cis</i>,<i>cis</i>-1,2,4,5-Cyclohexanetetracarboxylic acid and its dianhydride |
| Authors of publication |
Akira Uchida; Masatoshi Hasegawa; Hiroshi Manami |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2003 |
| Journal volume |
59 |
| Journal issue |
8 |
| Pages of publication |
o435 - o438 |
| a |
5.9425 ± 0.0018 Å |
| b |
12.436 ± 0.002 Å |
| c |
14.999 ± 0.002 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1108.4 ± 0.4 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
57 |
| Hermann-Mauguin space group symbol |
P b c m |
| Hall space group symbol |
-P 2c 2b |
| Residual factor for all reflections |
0.047 |
| Residual factor for significantly intense reflections |
0.0407 |
| Weighted residual factors for significantly intense reflections |
0.1087 |
| Weighted residual factors for all reflections included in the refinement |
0.113 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.107 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2013491.html