Information card for entry 2013845
| Chemical name |
3,6-bis(2-chlorophenyl)-1,4-dihydro-1,2,4,5-tetrazine |
| Formula |
C14 H10 Cl2 N4 |
| Calculated formula |
C14 H10 Cl2 N4 |
| SMILES |
c1(c(cccc1)Cl)C1NN=C(c2c(cccc2)Cl)NN=1 |
| Title of publication |
Hydrogen-bonding patterns in two structural isomers of 3,6-bis(2-chlorophenyl)-1,4-dihydro-1,2,4,5-tetrazine |
| Authors of publication |
Zachara, Janusz; Madura, Izabela; Włostowski, Marek |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
1 |
| Pages of publication |
o57 - o59 |
| a |
16.002 ± 0.0012 Å |
| b |
9.4123 ± 0.0008 Å |
| c |
10.5752 ± 0.0007 Å |
| α |
90° |
| β |
121.664 ± 0.005° |
| γ |
90° |
| Cell volume |
1355.69 ± 0.19 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0449 |
| Residual factor for significantly intense reflections |
0.0357 |
| Weighted residual factors for significantly intense reflections |
0.0923 |
| Weighted residual factors for all reflections included in the refinement |
0.0985 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.04 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2013845.html