Information card for entry 2014448
| Chemical name |
1-Chloro-1,3,3,5,5-pentaphenoxycyclotriphosphazene |
| Formula |
C30 H25 Cl N3 O5 P3 |
| Calculated formula |
C30 H25 Cl N3 O5 P3 |
| SMILES |
ClP1(=NP(=NP(=N1)(Oc1ccccc1)Oc1ccccc1)(Oc1ccccc1)Oc1ccccc1)Oc1ccccc1 |
| Title of publication |
1-Chloro-1,3,3,5,5-pentaphenoxycyclotriphosphazene: a precursor of functionalized cyclophosphazene derivatives |
| Authors of publication |
Sopková-de Oliveira Santos, Jana; Bauchart, Diane; Besset, Celine; Dez, Isabelle |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
10 |
| Pages of publication |
o751 - o753 |
| a |
9.8044 ± 0.0007 Å |
| b |
21.3628 ± 0.0013 Å |
| c |
29.2053 ± 0.0015 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
6117 ± 0.7 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.123 |
| Residual factor for significantly intense reflections |
0.0512 |
| Weighted residual factors for significantly intense reflections |
0.1251 |
| Weighted residual factors for all reflections included in the refinement |
0.1534 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.014 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2014448.html