Information card for entry 2014542
| Chemical name |
9-Chloro-8-fluoro-4-phenyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline |
| Formula |
C17 H15 Cl F N O |
| Calculated formula |
C17 H15 Cl F N O |
| SMILES |
Clc1c(F)ccc2N[C@H]([C@@H]3[C@@H](OCC3)c12)c1ccccc1.Clc1c(F)ccc2N[C@@H]([C@H]3[C@H](OCC3)c12)c1ccccc1 |
| Title of publication |
Imino Diels–Alder adducts. I. Two furo[3,2-<i>c</i>]quinoline diastereoisomers |
| Authors of publication |
Ravikumar, K.; Mahesh, M.; Narayana Reddy, V. V. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
12 |
| Pages of publication |
o887 - o889 |
| a |
8.1796 ± 0.0006 Å |
| b |
17.9041 ± 0.0012 Å |
| c |
9.6562 ± 0.0007 Å |
| α |
90° |
| β |
91.017 ± 0.001° |
| γ |
90° |
| Cell volume |
1413.91 ± 0.17 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0545 |
| Residual factor for significantly intense reflections |
0.0495 |
| Weighted residual factors for significantly intense reflections |
0.1319 |
| Weighted residual factors for all reflections included in the refinement |
0.1362 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.079 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2014542.html