Information card for entry 2014602
| Common name |
tris(2,2'-bisoxazoline-k^2^N,N')nickel(II) diperchlorate |
| Chemical name |
tris[2,2'-bi(4,5-dihydrooxazole)-k^2^N,N']nickel(II) diperchlorate |
| Formula |
C18 H24 Cl2 N6 Ni O14 |
| Calculated formula |
C18 H24 Cl2 N6 Ni O14 |
| SMILES |
[Ni]123([N]4=C(C5=[N]1CCO5)OCC4)([N]1=C(C4=[N]2CCO4)OCC1)[N]1=C(C2=[N]3CCO2)OCC1.Cl(=O)(=O)(=O)[O-].Cl(=O)(=O)(=O)[O-] |
| Title of publication |
Tris(2,2'-bioxazoline-κ^2^<i>N</i>,<i>N</i>')copper(II) diperchlorate and tris(2,2'-bioxazoline-κ^2^<i>N</i>,<i>N</i>')nickel(II) diperchlorate |
| Authors of publication |
Lü, Zheng-Liang; Liu, Zhi-Liang; Zhang, De-Qing |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
3 |
| Pages of publication |
m147 - m150 |
| a |
9.3911 ± 0.0019 Å |
| b |
17.683 ± 0.004 Å |
| c |
16.743 ± 0.003 Å |
| α |
90° |
| β |
101.14 ± 0.03° |
| γ |
90° |
| Cell volume |
2728 ± 1 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.1164 |
| Residual factor for significantly intense reflections |
0.0511 |
| Weighted residual factors for significantly intense reflections |
0.0931 |
| Weighted residual factors for all reflections included in the refinement |
0.1039 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.933 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2014602.html