Information card for entry 2014803
| Chemical name |
(2,2'-Biquinoline-κ^2^N,N')chlorocopper(II) |
| Formula |
C18 H12 Cl2 Cu N2 |
| Calculated formula |
C18 H12 Cl2 Cu N2 |
| SMILES |
c1ccc2[n]3[Cu](Cl)([n]4c(c3ccc2c1)ccc1ccccc41)Cl |
| Title of publication |
(2,2'-Biquinoline-κ^2^<i>N</i>,<i>N</i>')dichloropalladium(II), -copper(II) and -zinc(II) |
| Authors of publication |
Muranishi, Yasunori; Wang, Yue; Odoko, Mamiko; Okabe, Nobuo |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
6 |
| Pages of publication |
m307 - m310 |
| a |
19.43 ± 0.003 Å |
| b |
8.528 ± 0.002 Å |
| c |
11.884 ± 0.003 Å |
| α |
90° |
| β |
125.991 ± 0.01° |
| γ |
90° |
| Cell volume |
1593.3 ± 0.6 Å3 |
| Cell temperature |
296.2 K |
| Ambient diffraction temperature |
296.2 K |
| Number of distinct elements |
5 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.1213 |
| Residual factor for significantly intense reflections |
0.0453 |
| Weighted residual factors for significantly intense reflections |
0.1075 |
| Weighted residual factors for all reflections included in the refinement |
0.1307 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.987 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2014803.html