Information card for entry 2014848
| Chemical name |
1,4-Bis(3-ethyl-5-oxo-4,5-dihydro-1H-1,2,4-triazol-4-yl)butane |
| Formula |
C12 H20 N6 O2 |
| Calculated formula |
C12 H20 N6 O2 |
| SMILES |
CCC1=NNC(=O)N1CCCCN1C(CC)=NNC1=O |
| Title of publication |
4,4'-Butane-1,4-diylbis[3-ethyl-1<i>H</i>-1,2,4-triazol-5(4<i>H</i>)-one] and 4-hydroxy-3-<i>n</i>-propyl-1<i>H</i>-1,2,4-triazol-5(4<i>H</i>)-one |
| Authors of publication |
Ocak Ískeleli, Nazan; Işık, Şamil; Sancak, Kemal; Şaşmaz, Selami; Ünver, Yasemin; Er, Mustafa |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
6 |
| Pages of publication |
o363 - o365 |
| a |
8.326 ± 0.005 Å |
| b |
13.588 ± 0.005 Å |
| c |
12.401 ± 0.005 Å |
| α |
90 ± 0.005° |
| β |
90 ± 0.005° |
| γ |
90 ± 0.005° |
| Cell volume |
1403 ± 1.1 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0663 |
| Residual factor for significantly intense reflections |
0.0333 |
| Weighted residual factors for significantly intense reflections |
0.0662 |
| Weighted residual factors for all reflections included in the refinement |
0.0715 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.804 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2014848.html