Information card for entry 2014950
| Chemical name |
1,3-Dibenzoyl-3,4,5,6-tetrahydropyrimidine-2(1H)-thione |
| Formula |
C18 H16 N2 O2 S |
| Calculated formula |
C18 H16 N2 O2 S |
| SMILES |
c1ccccc1C(=O)N1C(=S)N(C(=O)c2ccccc2)CCC1 |
| Title of publication |
1,3-Dibenzoylimidazolidine-2-thione and 1,3-dibenzoyl-3,4,5,6-tetrahydropyrimidine-2(1<i>H</i>)-thione |
| Authors of publication |
Kazak, Canan; Yilmaz, Veysel T.; Servi, Suleyman; Koca, Murat; Heinemann, Frank W. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
6 |
| Pages of publication |
o348 - o350 |
| a |
8.6803 ± 0.0006 Å |
| b |
21.946 ± 0.001 Å |
| c |
8.1845 ± 0.0009 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1559.1 ± 0.2 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
62 |
| Hermann-Mauguin space group symbol |
P n m a |
| Hall space group symbol |
-P 2ac 2n |
| Residual factor for all reflections |
0.0504 |
| Residual factor for significantly intense reflections |
0.0382 |
| Weighted residual factors for significantly intense reflections |
0.0896 |
| Weighted residual factors for all reflections included in the refinement |
0.0951 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.089 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2014950.html