Information card for entry 2015114
| Chemical name |
4,5-Bis(furoylsulfanyl)-1,3-dithiolane-2-thione |
| Formula |
C13 H6 O4 S5 |
| Calculated formula |
C13 H6 O4 S5 |
| SMILES |
S=C1SC(=C(S1)SC(=O)c1ccco1)SC(=O)c1ccco1 |
| Title of publication |
4,5-Bis(furoylsulfanyl)-1,3-dithiole-2-thione |
| Authors of publication |
Wang, Xin-Qiang; Yu, Wen-Tao; Xu, Dong; Wang, Yan-Ling; Li, Ting-Bin; Guo, Wen-Feng |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
10 |
| Pages of publication |
o583 - o585 |
| a |
7.2228 ± 0.0011 Å |
| b |
24.518 ± 0.003 Å |
| c |
5.033 ± 0.0007 Å |
| α |
90° |
| β |
120.521 ± 0.01° |
| γ |
90° |
| Cell volume |
767.8 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
8 |
| Hermann-Mauguin space group symbol |
C 1 m 1 |
| Hall space group symbol |
C -2y |
| Residual factor for all reflections |
0.0495 |
| Residual factor for significantly intense reflections |
0.0349 |
| Weighted residual factors for significantly intense reflections |
0.0814 |
| Weighted residual factors for all reflections included in the refinement |
0.0907 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.02 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2015114.html