Information card for entry 2015779
| Chemical name |
[(Acetato-κ^2^O,O')(di-2-pyridylamine-κ^2^N^2^,N^2'^)copper(II)]-μ-acetato- κ^2^O:O'-[(acetato-κO)(di-2-pyridylamine-κ^2^N^2^,N^2'^)(isothiocyanato- κN)copper(II)] |
| Formula |
C27 H27 Cu2 N7 O6 S |
| Calculated formula |
C27 H27 Cu2 N7 O6 S |
| SMILES |
[Cu]1(OC(=O)C)(OC(=[O][Cu]23(OC(=[O]2)C)[n]2ccccc2Nc2[n]3cccc2)C)([n]2ccccc2Nc2[n]1cccc2)N=C=S |
| Title of publication |
μ-Acetato-1:2κ^2^<i>O</i>:<i>O</i>'-diacetato-1κ^2^<i>O</i>,<i>O</i>';2κ<i>O</i>-bis(di-2-pyridylamine)-1κ^2^<i>N</i>,<i>N</i>';2κ^2^<i>N</i>,<i>N</i>'-isothiocyanato-2κ<i>N</i>-dicopper(II) |
| Authors of publication |
Youngme, Sujittra; Chotkhun, Thidarat; Chaichit, Narongsak |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
2 |
| Pages of publication |
m59 - m61 |
| a |
9.6949 ± 0.0002 Å |
| b |
10.4915 ± 0.0002 Å |
| c |
16.9001 ± 0.0002 Å |
| α |
97.645 ± 0.001° |
| β |
101.458 ± 0.001° |
| γ |
113.215 ± 0.001° |
| Cell volume |
1505.09 ± 0.05 Å3 |
| Cell temperature |
273 ± 2 K |
| Ambient diffraction temperature |
273 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0501 |
| Residual factor for significantly intense reflections |
0.0375 |
| Weighted residual factors for significantly intense reflections |
0.0879 |
| Weighted residual factors for all reflections included in the refinement |
0.0989 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.049 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2015779.html