Information card for entry 2016251
| Chemical name |
2,2-Dichloro-1,3-bis(trimethylsilyl)-1,3-diaza-2-silacyclopentane |
| Formula |
C8 H22 Cl2 N2 Si3 |
| Calculated formula |
C8 H22 Cl2 N2 Si3 |
| SMILES |
C1N([Si](Cl)(N(C1)[Si](C)(C)C)Cl)[Si](C)(C)C |
| Title of publication |
2,2-Dichloro-1,3-bis(trimethylsilyl)-1,3-diaza-2-silacyclopentane |
| Authors of publication |
Böhme, Uwe; Bendrath, Franziska; Günther, Betty |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
11 |
| Pages of publication |
o631 - o632 |
| a |
6.8227 ± 0.0002 Å |
| b |
13.4226 ± 0.0004 Å |
| c |
17.5317 ± 0.0005 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1605.52 ± 0.08 Å3 |
| Cell temperature |
153 ± 2 K |
| Ambient diffraction temperature |
153 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
60 |
| Hermann-Mauguin space group symbol |
P b c n |
| Hall space group symbol |
-P 2n 2ab |
| Residual factor for all reflections |
0.0314 |
| Residual factor for significantly intense reflections |
0.0253 |
| Weighted residual factors for significantly intense reflections |
0.0644 |
| Weighted residual factors for all reflections included in the refinement |
0.0683 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.968 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2016251.html