Information card for entry 2016458
| Chemical name |
4-propyl-3,4,5,6-tetrahydro-2H-naphtho[1,2-b]pyran-5,6-dione |
| Formula |
C16 H16 O3 |
| Calculated formula |
C16 H16 O3 |
| SMILES |
O=C1C(=O)C2=C(OCC[C@@H]2CCC)c2c1cccc2 |
| Title of publication |
Two polymorphs of 4-propyl-3,4-dihydro-2<i>H</i>-naphtho[1,2-<i>b</i>]pyran-5,6-dione |
| Authors of publication |
Sugiono, Erli; Bolte, Michael |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
2 |
| Pages of publication |
o84 - o86 |
| a |
5.2833 ± 0.0007 Å |
| b |
6.3043 ± 0.0008 Å |
| c |
38.753 ± 0.006 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1290.8 ± 0.3 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.089 |
| Residual factor for significantly intense reflections |
0.0462 |
| Weighted residual factors for significantly intense reflections |
0.0963 |
| Weighted residual factors for all reflections included in the refinement |
0.1077 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.835 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2016458.html