Information card for entry 2018052
| Chemical name |
(<i>E</i>,<i>E</i>)-<i>N</i>,<i>N</i>'-bis(4-nitrobenzylidene)benzene- 1,4-diamine |
| Formula |
C20 H14 N4 O4 |
| Calculated formula |
C20 H14 N4 O4 |
| SMILES |
c1(ccc(cc1)N(=O)=O)/C=N/c1ccc(/N=C/c2ccc(cc2)N(=O)=O)cc1 |
| Title of publication |
Conformational polymorphism of (<i>E</i>,<i>E</i>)-<i>N</i>,<i>N</i>'-bis(4-nitrobenzylidene)benzene-1,4-diamine |
| Authors of publication |
Collas, Alain; Zeller, Matthias; Blockhuys, Frank |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
5 |
| Pages of publication |
o171 - o174 |
| a |
6.567 ± 0.001 Å |
| b |
5.0227 ± 0.0007 Å |
| c |
26.723 ± 0.005 Å |
| α |
90° |
| β |
102.558 ± 0.004° |
| γ |
90° |
| Cell volume |
860.3 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0677 |
| Residual factor for significantly intense reflections |
0.0398 |
| Weighted residual factors for significantly intense reflections |
0.0927 |
| Weighted residual factors for all reflections included in the refinement |
0.1057 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.016 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2018052.html