Information card for entry 2018292
| Chemical name |
(<i>Z</i>)-3-Methyl-<i>N</i>-(7-nitroacridin-3-yl)-2,3-dihydro- 1,3-benzothiazol-2-imine |
| Formula |
C21 H14 N4 O2 S |
| Calculated formula |
C21 H14 N4 O2 S |
| SMILES |
S1/C(N(c2ccccc12)C)=N\c1cc2nc3ccc(cc3cc2cc1)N(=O)=O |
| Title of publication |
(<i>Z</i>)-3-Methyl-<i>N</i>-(7-nitroacridin-3-yl)-2,3-dihydro-1,3-benzothiazol-2-imine from laboratory powder diffraction data |
| Authors of publication |
Vallcorba, Oriol; Latorre, Sonia; Alcobé, Xavier; Miravitlles, Carles; Rius, Jordi |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
11 |
| Pages of publication |
o425 - o427 |
| a |
36.627 ± 0.004 Å |
| b |
12.5071 ± 0.001 Å |
| c |
7.5769 ± 0.0004 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3471 ± 0.5 Å3 |
| Cell temperature |
298 K |
| Ambient diffraction temperature |
298 K |
| Number of distinct elements |
5 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Goodness-of-fit parameter for all reflections |
1.667 |
| Method of determination |
powder diffraction |
| Diffraction radiation wavelength |
1.54059 Å |
| Diffraction radiation type |
CuKα~1~ |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2018292.html