Information card for entry 2019552
| Chemical name |
<i>N</i>,<i>N</i>,<i>N</i>',<i>N</i>'-Tetraethyl-4,4'-(diazenediyl)dianiline |
| Formula |
C20 H28 N4 |
| Calculated formula |
C20 H28 N4 |
| SMILES |
CCN(c1ccc(cc1)/N=N/c1ccc(cc1)N(CC)CC)CC |
| Title of publication |
Substituent effects in <i>trans</i>-<i>p</i>,<i>p</i>'-disubstituted azobenzenes: X-ray structures at 100K and DFT-calculated structures |
| Authors of publication |
Gajda, Katarzyna; Zarychta, Bartosz; Daszkiewicz, Zdzisław; Domański, Andrzej A.; Ejsmont, Krzysztof |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
6 |
| Pages of publication |
575 - 579 |
| a |
14.0805 ± 0.0003 Å |
| b |
7.9682 ± 0.0002 Å |
| c |
21.189 ± 0.0005 Å |
| α |
90° |
| β |
128.989 ± 0.002° |
| γ |
90° |
| Cell volume |
1847.82 ± 0.09 Å3 |
| Cell temperature |
100 ± 0.1 K |
| Ambient diffraction temperature |
100 ± 0.1 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0612 |
| Residual factor for significantly intense reflections |
0.0435 |
| Weighted residual factors for significantly intense reflections |
0.1192 |
| Weighted residual factors for all reflections included in the refinement |
0.1257 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.077 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2019552.html