Information card for entry 2019601
| Chemical name |
1,1,2,2-Tetra-<i>tert</i>-butyl-1,2-diphenyldisilane |
| Formula |
C28 H46 Si2 |
| Calculated formula |
C28 H46 Si2 |
| SMILES |
[Si]([Si](c1ccccc1)(C(C)(C)C)C(C)(C)C)(c1ccccc1)(C(C)(C)C)C(C)(C)C |
| Title of publication |
A low-temperature modification of hexa-<i>tert</i>-butyldisilane and a new polymorph of 1,1,2,2-tetra-<i>tert</i>-butyl-1,2-diphenyldisilane |
| Authors of publication |
Scholz, Stefan; Lerner, Hans-Wolfram; Bats, Jan W. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
7 |
| Pages of publication |
697 - 701 |
| a |
9.024 ± 0.0011 Å |
| b |
17.566 ± 0.002 Å |
| c |
18.961 ± 0.003 Å |
| α |
116.476 ± 0.006° |
| β |
95.018 ± 0.007° |
| γ |
90.263 ± 0.01° |
| Cell volume |
2676.9 ± 0.6 Å3 |
| Cell temperature |
157 ± 2 K |
| Ambient diffraction temperature |
157 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1053 |
| Residual factor for significantly intense reflections |
0.0498 |
| Weighted residual factors for significantly intense reflections |
0.1007 |
| Weighted residual factors for all reflections included in the refinement |
0.1157 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.005 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2019601.html