Information card for entry 2019652
| Chemical name |
[(1<i>R</i>,1'<i>R</i>,2<i>R</i>,2'<i>R</i>)-2,2'-Bis(diphenylphosphanyl)-1,1'-dicyclopentane](η^4^-norbornadiene)rhodium(I) tetrafluoroborate |
| Formula |
C41 H44 B F4 P2 Rh |
| Calculated formula |
C41 H44 B F4 P2 Rh |
| SMILES |
[Rh]1234([P]([C@@H]5CCC[C@@H]5[C@H]5CCC[C@H]5[P]1(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1)[C@@H]1[C@H]2C2[C@H]3[C@H]4C1C2.[B](F)(F)(F)[F-] |
| Title of publication |
Two precatalysts for application in asymmetric homogeneous hydrogenation |
| Authors of publication |
Meißner, Antje; Pribbenow, Cornelia; Drexler, Hans-Joachim; Heller, Detlef |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
10 |
| Pages of publication |
941 - 944 |
| a |
10.002 ± 0.002 Å |
| b |
9.0293 ± 0.0018 Å |
| c |
39.251 ± 0.008 Å |
| α |
90° |
| β |
95.17 ± 0.03° |
| γ |
90° |
| Cell volume |
3530.4 ± 1.2 Å3 |
| Cell temperature |
200 ± 2 K |
| Ambient diffraction temperature |
200 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0781 |
| Residual factor for significantly intense reflections |
0.0463 |
| Weighted residual factors for significantly intense reflections |
0.0951 |
| Weighted residual factors for all reflections included in the refinement |
0.1026 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.833 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2019652.html