Information card for entry 2020085
| Chemical name |
6,6,12,12-Tetrachlorotricyclo[8.2.0.0^4,7^]dodecane-5,11-dione |
| Formula |
C12 H12 Cl4 O2 |
| Calculated formula |
C12 H12 Cl4 O2 |
| SMILES |
ClC1(Cl)[C@H]2CC[C@H]3C(=O)C(Cl)(Cl)[C@H]3CC[C@H]2C1=O.ClC1(Cl)[C@@H]2CC[C@@H]3C(=O)C(Cl)(Cl)[C@@H]3CC[C@@H]2C1=O |
| Title of publication |
Crystal structure of 6,6,12,12-tetrachlorotricyclo[8.2.0.04,7]dodecane-5,11-dione |
| Authors of publication |
Turan Akın, Esra; Hökelek, Tuncer |
| Journal of publication |
Acta Crystallographica Section E Crystallographic Communications |
| Year of publication |
2015 |
| Journal volume |
71 |
| Journal issue |
9 |
| Pages of publication |
1000 |
| a |
10.9786 ± 0.0003 Å |
| b |
10.9374 ± 0.0003 Å |
| c |
23.5429 ± 0.0005 Å |
| α |
90° |
| β |
97.554 ± 0.002° |
| γ |
90° |
| Cell volume |
2802.43 ± 0.12 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1102 |
| Residual factor for significantly intense reflections |
0.0643 |
| Weighted residual factors for significantly intense reflections |
0.116 |
| Weighted residual factors for all reflections included in the refinement |
0.1309 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.104 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2020085.html