Information card for entry 2020840
| Common name |
dibenzo-21-crown-7 |
| Chemical name |
Dibenzo[<i>b</i>,<i>k</i>][1,4,7,10,13,16,19]heptaoxacyclohenicosa-2,11-diene |
| Formula |
C22 H28 O7 |
| Calculated formula |
C22 H28 O7 |
| SMILES |
C1OCCOc2c(cccc2)OCCOCCOCCOc2c(cccc2)OC1 |
| Title of publication |
Invariom-model refinement and Hirshfeld surface analysis of well-ordered solvent-free dibenzo-21-crown-7 |
| Authors of publication |
Wiedemann, Dennis; Kohl, Julia |
| Journal of publication |
Acta Crystallographica Section C Structural Chemistry |
| Year of publication |
2017 |
| Journal volume |
73 |
| Journal issue |
9 |
| a |
4.9801 ± 0.0001 Å |
| b |
17.4771 ± 0.0002 Å |
| c |
23.1 ± 0.0002 Å |
| α |
90° |
| β |
94.124 ± 0.001° |
| γ |
90° |
| Cell volume |
2005.37 ± 0.05 Å3 |
| Cell temperature |
150 ± 0.1 K |
| Ambient diffraction temperature |
150 ± 0.1 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0324 |
| Residual factor for significantly intense reflections |
0.0296 |
| Weighted residual factors for all reflections included in the refinement |
0.0836 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.9807 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2020840.html