Information card for entry 2021804
| Chemical name |
3-[5-(Pyridin-4-yl)-1,3,4-oxadiazol-2-yl]-2<i>H</i>-chromen-2-one |
| Formula |
C16 H9 N3 O3 |
| Calculated formula |
C16 H9 N3 O3 |
| SMILES |
o1c2ccccc2cc(c1=O)c1oc(nn1)c1ccncc1 |
| Title of publication |
Polymorphism of 3-(5-phenyl-1,3,4-oxadiazol-2-yl)- and 3-[5-(pyridin-4-yl)-1,3,4-oxadiazol-2-yl]-2<i>H</i>-chromen-2-ones |
| Authors of publication |
Shishkina, Svitlana V.; Konovalova, Irina S.; Trostianko, Pavlo V.; Geleverya, Anna O.; Kovalenko, Sergiy M.; Bunyatyan, Natalya D. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2019 |
| Journal volume |
75 |
| Journal issue |
11 |
| a |
3.7788 ± 0.0009 Å |
| b |
9.9655 ± 0.0017 Å |
| c |
16.899 ± 0.003 Å |
| α |
90° |
| β |
93.466 ± 0.019° |
| γ |
90° |
| Cell volume |
635.2 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
7 |
| Hermann-Mauguin space group symbol |
P 1 n 1 |
| Hall space group symbol |
P -2yac |
| Residual factor for all reflections |
0.1015 |
| Residual factor for significantly intense reflections |
0.0785 |
| Weighted residual factors for significantly intense reflections |
0.1858 |
| Weighted residual factors for all reflections included in the refinement |
0.2095 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.004 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2021804.html