Information card for entry 2022233
| Chemical name |
(5-Bromo-3-hydroxybenzofuran-2-yl)(4-fluorophenyl)methanone |
| Formula |
C15 H8 Br F O3 |
| Calculated formula |
C15 H8 Br F O3 |
| SMILES |
o1c(c(c2cc(ccc12)Br)O)C(=O)c1ccc(cc1)F |
| Title of publication |
Synthesis, structure and <i>in vitro</i> cytotoxicity testing of some 2-aroylbenzofuran-3-ols |
| Authors of publication |
Cong, Nguyen Tien; Trang, Huynh Thi Xuan; Dung, Pham Duc; Phuong, Tran Hoang; Trung, Vu Quoc; Dat, Nguyen Dang; Anh, Dang Thi Tuyet; Tuyen, Nguyen Van; Van Meervelt, Luc |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2020 |
| Journal volume |
76 |
| Journal issue |
9 |
| a |
3.8598 ± 0.0004 Å |
| b |
11.7229 ± 0.001 Å |
| c |
27.679 ± 0.002 Å |
| α |
90° |
| β |
93.255 ± 0.009° |
| γ |
90° |
| Cell volume |
1250.4 ± 0.19 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0699 |
| Residual factor for significantly intense reflections |
0.0452 |
| Weighted residual factors for significantly intense reflections |
0.0883 |
| Weighted residual factors for all reflections included in the refinement |
0.0972 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.074 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2022233.html