Information card for entry 2100527
| Chemical name |
(E,E)-1,4-Bis(2-nitrophenyl)-2,3-diaza-1,3-butadiene |
| Formula |
C14 H10 N4 O4 |
| Calculated formula |
C14 H10 N4 O4 |
| SMILES |
c1(/C=N/N=C/c2c(cccc2)N(=O)=O)c(cccc1)N(=O)=O |
| Title of publication |
Isomers and polymorphs of (<i>E</i>,<i>E</i>)-1,4-bis(nitrophenyl)-2,3-diaza-1,3-butadienes |
| Authors of publication |
Glidewell, Christopher; Low, John Nicolson; Skakle, Janet M.S.; Wardell, James L. |
| Journal of publication |
Acta Crystallographica Section B |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
4 |
| Pages of publication |
666 - 675 |
| a |
7.7809 ± 0.0002 Å |
| b |
14.7825 ± 0.0006 Å |
| c |
6.2196 ± 0.0002 Å |
| α |
90° |
| β |
113.106 ± 0.002° |
| γ |
90° |
| Cell volume |
658 ± 0.04 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0753 |
| Residual factor for significantly intense reflections |
0.0599 |
| Weighted residual factors for significantly intense reflections |
0.1502 |
| Weighted residual factors for all reflections included in the refinement |
0.1599 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.017 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2100527.html