Information card for entry 2102852
| Chemical name |
cis-1,2-cyclohexanediol |
| Formula |
C6 H12 O2 |
| Calculated formula |
C6 H12 O2 |
| SMILES |
O[C@H]1[C@@H](O)CCCC1.O[C@@H]1[C@H](O)CCCC1 |
| Title of publication |
Solid-state compounds of stereoisomers: <i>cis</i> and <i>trans</i> isomers of 1,2-cyclohexanediol and 2,3-tetralindiol |
| Authors of publication |
Lloyd, Michael A.; Patterson, Garth E.; Simpson, Greg H.; Duncan, Laura L.; King, Daniel P.; Fu, Yigang; Patrick, Brian O.; Parkin, Sean; Brock, Carolyn Pratt |
| Journal of publication |
Acta Crystallographica Section B |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
3 |
| Pages of publication |
433 - 447 |
| a |
8.545 ± 0.002 Å |
| b |
7.588 ± 0.001 Å |
| c |
19.717 ± 0.004 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1278.4 ± 0.4 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0621 |
| Residual factor for significantly intense reflections |
0.0466 |
| Weighted residual factors for significantly intense reflections |
0.095 |
| Weighted residual factors for all reflections included in the refinement |
0.1005 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.137 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2102852.html