Information card for entry 2103289
| Chemical name |
2-Amino-4,6-bis(benzyloxy)pyrimidine |
| Formula |
C18 H17 N3 O2 |
| Calculated formula |
C18 H17 N3 O2 |
| SMILES |
n1c(N)nc(OCc2ccccc2)cc1OCc1ccccc1 |
| Title of publication |
Amino-substituted O^6^-benzyl-5-nitrosopyrimidines: interplay of molecular, molecular-electronic and supramolecular structures |
| Authors of publication |
Quesada, Antonio; Marchal, Antonio; Melguizo, Manuel; Nogueras, Manuel; Sánchez, Adolfo; Low, John N.; Cannon, Debbie; Farrell, Dorcas M. M.; Glidewell, Christopher |
| Journal of publication |
Acta Crystallographica Section B |
| Year of publication |
2002 |
| Journal volume |
58 |
| Journal issue |
2 |
| Pages of publication |
300 - 315 |
| a |
32.4902 ± 0.0009 Å |
| b |
7.5034 ± 0.0002 Å |
| c |
12.7804 ± 0.0004 Å |
| α |
90° |
| β |
98.879 ± 0.0016° |
| γ |
90° |
| Cell volume |
3078.36 ± 0.15 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0628 |
| Residual factor for significantly intense reflections |
0.0442 |
| Weighted residual factors for significantly intense reflections |
0.106 |
| Weighted residual factors for all reflections included in the refinement |
0.115 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.044 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2103289.html