Information card for entry 2106004
| Chemical name |
(2S,4aS,6aR,6aS,6bR,8aR,10S,12aS,14bR)-10-(3-carboxypropanoyloxy)- 2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10,11,12,14b- dodecahydro-1H-picene-2-carboxylic acid propionic acid solvate |
| Formula |
C37 H56 O9 |
| Calculated formula |
C37 H56 O9 |
| SMILES |
C1C[C@@H](C([C@@H]2CC[C@@]3([C@@H]([C@@]12C)C(=O)C=C1[C@]3(CC[C@@]2([C@H]1C[C@@](CC2)(C)C(=O)O)C)C)C)(C)C)OC(=O)CCC(=O)O.OC(=O)CC |
| Title of publication |
Solid-state supramolecular architecture of carbenoxolone – comparative studies with glycyrrhetinic and glycyrrhizic acids |
| Authors of publication |
Tykarska, Ewa; Gdaniec, Maria |
| Journal of publication |
Acta Crystallographica Section B |
| Year of publication |
2015 |
| Journal volume |
71 |
| Journal issue |
1 |
| a |
13.064 ± 0.0003 Å |
| b |
7.319 ± 0.0002 Å |
| c |
18.617 ± 0.0004 Å |
| α |
90° |
| β |
103.515 ± 0.002° |
| γ |
90° |
| Cell volume |
1730.78 ± 0.07 Å3 |
| Cell temperature |
130 ± 2 K |
| Ambient diffraction temperature |
130 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0394 |
| Residual factor for significantly intense reflections |
0.0376 |
| Weighted residual factors for significantly intense reflections |
0.0966 |
| Weighted residual factors for all reflections included in the refinement |
0.0988 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.022 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2106004.html