Information card for entry 2200162
| Common name |
dihydroparthenolide diol |
| Chemical name |
2,10-dihydroxy-1,6,10-trimethyl-4,14-dioxztricyclo[9.2.1.0^3,7^]tetradecan-5-one |
| Formula |
C15 H24 O5 |
| Calculated formula |
C15 H24 O5 |
| SMILES |
O1[C@@H]2[C@@H](O)[C@]3(O[C@H](CC3)[C@](O)(CC[C@H]2[C@@H](C1=O)C)C)C |
| Title of publication |
Dihydroparthenolide diol, a novel sesquiterpene lactone |
| Authors of publication |
Rugutt, Joseph K.; Fronczek, Frank R.; Franzblau, Scott G.; Warner, Isiah M. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2001 |
| Journal volume |
57 |
| Journal issue |
4 |
| Pages of publication |
o323 - o325 |
| a |
9.2706 ± 0.0013 Å |
| b |
10.4565 ± 0.0008 Å |
| c |
15.094 ± 0.003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1463.2 ± 0.4 Å3 |
| Cell temperature |
300 K |
| Ambient diffraction temperature |
300 K |
| Number of distinct elements |
3 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.049 |
| Residual factor for significantly intense reflections |
0.044 |
| Weighted residual factors for all reflections included in the refinement |
0.128 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.068 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2200162.html