Information card for entry 2200370
| Formula |
C24 H46 N6 |
| Calculated formula |
C24 H46 N6 |
| SMILES |
C[C@@H]1N[C@@H](C)CN(CCC#N)C(C)(C)C[C@H](N[C@@H](CN(C(C1)(C)C)CCC#N)C)C |
| Title of publication |
<i>trans</i>-(3<i>S</i>,5<i>S</i>,10<i>R</i>,12<i>R</i>)-1,8-Bis(2-cyanoethyl)-<i>C</i>-<i>meso</i>-3,5,7,7,10,12,14,14-octamethyl-1,4,8,11-tetraazacyclotetradecane |
| Authors of publication |
Roy, Tapashi G.; Hazari, Saroj K. S.; Dey, Benu K.; Miah, H. A.; Tiekink, Edward R. T. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2001 |
| Journal volume |
57 |
| Journal issue |
6 |
| Pages of publication |
o524 - o525 |
| a |
7.974 ± 0.003 Å |
| b |
17.685 ± 0.004 Å |
| c |
9.007 ± 0.006 Å |
| α |
90° |
| β |
98.74 ± 0.04° |
| γ |
90° |
| Cell volume |
1255.4 ± 1 Å3 |
| Cell temperature |
173 K |
| Ambient diffraction temperature |
173 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.078 |
| Residual factor for significantly intense reflections |
0.045 |
| Weighted residual factors for all reflections included in the refinement |
0.143 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.04 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2200370.html