Information card for entry 2200718
| Chemical name |
(R/S)-3-(3-Methyl-2-butylamino)-4H-pyrido[4,3-e]-1,2,4-thiadiazine 1,1-dioxide hydrate |
| Formula |
C11 H18 N4 O3 S |
| Calculated formula |
C11 H18 N4 O3 S |
| SMILES |
S1(=O)(=O)N=C(Nc2ccncc12)NC(C)C(C)C.O |
| Title of publication |
(<i>R</i>/<i>S</i>)-3-(3-Methyl-2-butylamino)-4<i>H</i>-pyrido[4,3-<i>e</i>]-1,2,4-thiadiazine 1,1-dioxide monohydrate |
| Authors of publication |
Dupont, Léon; De Tullio, Pascal; Tinant, Bernard; Pirotte, Bernard |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2001 |
| Journal volume |
57 |
| Journal issue |
11 |
| Pages of publication |
o1050 - o1051 |
| a |
26.198 ± 0.005 Å |
| b |
26.198 ± 0.005 Å |
| c |
11.024 ± 0.007 Å |
| α |
90° |
| β |
90° |
| γ |
120° |
| Cell volume |
6552 ± 5 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
148 |
| Hermann-Mauguin space group symbol |
R -3 :H |
| Hall space group symbol |
-R 3 |
| Residual factor for all reflections |
0.1055 |
| Residual factor for significantly intense reflections |
0.0774 |
| Weighted residual factors for all reflections included in the refinement |
0.2508 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.052 |
| Diffraction radiation wavelength |
1.5418 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2200718.html