Information card for entry 2201751
| Chemical name |
[(1-tert-Butyl-2-phenylvinylamino)(dimethylamino)dimethylsilyl-κ^2^N,N'] (N,N,N',N'-tetramethylenediamine-κ^2^N,N')lithium(I) |
| Formula |
C22 H43 Li N4 Si |
| Calculated formula |
C22 H43 Li N4 Si |
| SMILES |
[Li]12(N([Si]([N]1(C)C)(C)C)/C(=C\c1ccccc1)C(C)(C)C)[N](C)(C)CC[N]2(C)C |
| Title of publication |
[(1-<i>tert</i>-Butyl-2-phenylvinylamino)(dimethylamino)dimethylsilyl-κ^2^<i>N,N</i>'] (<i>N,N,N</i>',<i>N</i>'-tetramethylenediamine-κ^2^<i>N,N</i>')lithium(I) |
| Authors of publication |
He-Ping Shi; Dian-Sheng Liu; Shu-Ping Huang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2003 |
| Journal volume |
59 |
| Journal issue |
6 |
| Pages of publication |
m339 - m341 |
| a |
14.819 ± 0.003 Å |
| b |
9.4142 ± 0.0016 Å |
| c |
18.635 ± 0.003 Å |
| α |
90° |
| β |
97.674 ± 0.003° |
| γ |
90° |
| Cell volume |
2576.5 ± 0.8 Å3 |
| Cell temperature |
178 ± 2 K |
| Ambient diffraction temperature |
178 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.1027 |
| Residual factor for significantly intense reflections |
0.0584 |
| Weighted residual factors for significantly intense reflections |
0.0582 |
| Weighted residual factors for all reflections included in the refinement |
0.0658 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.833 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2201751.html