Information card for entry 2201780
| Chemical name |
(Z)-3-[(1-Methylethyl)thiomethylene]-4-phenyl-1,4-pentadiene- 1,1,2-tricarbonitrile |
| Formula |
C18 H15 N3 S |
| Calculated formula |
C18 H15 N3 S |
| SMILES |
S(\C=C(C(=C(C#N)C#N)C#N)\C(=C)c1ccccc1)C(C)C |
| Title of publication |
(<i>Z</i>)-3-[(1-Methylethyl)thiomethylene]-4-phenyl-1,4-pentadiene-1,1,2-tricarbonitrile |
| Authors of publication |
Jones, Peter G.; Bubenitschek, Peter; Hopf, Henning; Kreutzer, Martin |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2003 |
| Journal volume |
59 |
| Journal issue |
1 |
| Pages of publication |
o92 - o93 |
| a |
10.766 ± 0.003 Å |
| b |
8.243 ± 0.002 Å |
| c |
18.47 ± 0.005 Å |
| α |
90° |
| β |
93.37 ± 0.02° |
| γ |
90° |
| Cell volume |
1636.3 ± 0.8 Å3 |
| Cell temperature |
178 ± 2 K |
| Ambient diffraction temperature |
178 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0919 |
| Residual factor for significantly intense reflections |
0.0548 |
| Weighted residual factors for significantly intense reflections |
0.1323 |
| Weighted residual factors for all reflections included in the refinement |
0.1606 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.016 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2201780.html