Information card for entry 2202031
| Chemical name |
(Z)-α-Chloromethyl-3,3'4,4'-tetramethoxystilbene |
| Formula |
C19 H21 Cl O4 |
| Calculated formula |
C19 H21 Cl O4 |
| SMILES |
ClC\C(=C/c1cc(OC)c(OC)cc1)c1cc(OC)c(OC)cc1 |
| Title of publication |
(<i>Z</i>)-α-Chloromethyl-3,3',4,4'-tetramethoxystilbene |
| Authors of publication |
Stomberg, Rolf; Langer, Vratislav; Li, Shiming; Lundquist, Knut |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2003 |
| Journal volume |
59 |
| Journal issue |
4 |
| Pages of publication |
o583 - o585 |
| a |
9.2561 ± 0.0001 Å |
| b |
10.0669 ± 0.0002 Å |
| c |
11.5351 ± 0.0002 Å |
| α |
104.62 ± 0.001° |
| β |
108.441 ± 0.001° |
| γ |
109.692 ± 0.001° |
| Cell volume |
879.06 ± 0.03 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0471 |
| Residual factor for significantly intense reflections |
0.0384 |
| Weighted residual factors for significantly intense reflections |
0.1058 |
| Weighted residual factors for all reflections included in the refinement |
0.113 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.018 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2202031.html
