Information card for entry 2202088
| Common name |
[1,2-Bis(methylthio)ethane-S,S']dichlorozinc(II) |
| Chemical name |
[1,2-Bis(methylthio)ethane-S,S']dichlorozinc(II) |
| Formula |
C4 H10 Cl2 S2 Zn |
| Calculated formula |
C4 H10 Cl2 S2 Zn |
| SMILES |
[Zn]1(Cl)(Cl)[S](C)CC[S]1C |
| Title of publication |
[1,2-Bis(methylthio)ethane-κ^2^<i>S,S</i>']dichlorozinc(II) |
| Authors of publication |
Parvez, Masood; Clark, Peter D.; Yao, Hong |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2003 |
| Journal volume |
59 |
| Journal issue |
6 |
| Pages of publication |
m313 - m314 |
| a |
7.311 ± 0.0014 Å |
| b |
17.5535 ± 0.0015 Å |
| c |
7.7836 ± 0.0015 Å |
| α |
90° |
| β |
104.984 ± 0.014° |
| γ |
90° |
| Cell volume |
964.9 ± 0.3 Å3 |
| Cell temperature |
170 ± 2 K |
| Ambient diffraction temperature |
170 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.088 |
| Residual factor for significantly intense reflections |
0.04 |
| Weighted residual factors for significantly intense reflections |
0.101 |
| Weighted residual factors for all reflections included in the refinement |
0.117 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.1 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2202088.html