Information card for entry 2202262
| Common name |
Hydrindantin |
| Chemical name |
2,2'-Dihydroxy-[2,2'-bi-1H-indene]-1,1',3,3'-(2H,2'H)-tetrone dihydrate |
| Formula |
C18 H14 O8 |
| Calculated formula |
C18 H14 O8 |
| SMILES |
O=C1c2ccccc2C(=O)C1(O)C1(O)C(=O)c2c(C1=O)cccc2.O.O |
| Title of publication |
2,2'-Dihydroxy-[2,2'-bi-1<i>H</i>-indene]-1,1',3,3'-(2<i>H</i>,2'<i>H</i>)-tetrone dihydrate |
| Authors of publication |
Daniel E. Lynch |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2003 |
| Journal volume |
59 |
| Journal issue |
8 |
| Pages of publication |
o1133 - o1134 |
| a |
8.4479 ± 0.0004 Å |
| b |
12.4759 ± 0.0006 Å |
| c |
7.9293 ± 0.0004 Å |
| α |
90° |
| β |
100.634 ± 0.003° |
| γ |
90° |
| Cell volume |
821.36 ± 0.07 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1017 |
| Residual factor for significantly intense reflections |
0.0522 |
| Weighted residual factors for significantly intense reflections |
0.1018 |
| Weighted residual factors for all reflections included in the refinement |
0.1162 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2202262.html