Information card for entry 2202371
| Chemical name |
Bis[1,1,3,3-tetramethyl-1,3-bis(dichloroacetato)distannoxane] |
| Formula |
C16 H28 Cl8 O10 Sn4 |
| Calculated formula |
C16 H28 Cl8 O10 Sn4 |
| SMILES |
C[Sn]12(C)[O]([Sn](C)(OC(=[O]1)C(Cl)Cl)(OC(C(Cl)Cl)=O)C)[Sn]1(C)(C)[O]2[Sn](C)(C)([O]=C(C(Cl)Cl)O1)OC(=O)C(Cl)Cl |
| Title of publication |
Bis[1,1,3,3-tetramethyl-1,3-bis(dichloroacetato)distannoxane] |
| Authors of publication |
Amini, Mostafa M.; Abadi, Shabnam Hossein; Mirzaee, Mahdi; Yang, Shi-Yao; Ng, Seik Weng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2003 |
| Journal volume |
59 |
| Journal issue |
10 |
| Pages of publication |
m876 - m877 |
| a |
8.9026 ± 0.0005 Å |
| b |
9.6131 ± 0.0006 Å |
| c |
11.2145 ± 0.0007 Å |
| α |
91.674 ± 0.001° |
| β |
113.129 ± 0.001° |
| γ |
96.651 ± 0.001° |
| Cell volume |
873.74 ± 0.09 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.079 |
| Residual factor for significantly intense reflections |
0.059 |
| Weighted residual factors for significantly intense reflections |
0.116 |
| Weighted residual factors for all reflections included in the refinement |
0.129 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.081 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2202371.html