Information card for entry 2202380
| Chemical name |
2'-Benzoyl-1',2,2',3,4',5',6',6a'-octahydro-1H-indan-2-spiro-3'- (3'H-pyrrolizine)-1'-spiro-3''-1H-indoline-1,2'',3-trione |
| Formula |
C29 H22 N2 O4 |
| Calculated formula |
C29 H22 N2 O4 |
| SMILES |
N1C(=O)[C@@]2(c3ccccc13)[C@H](C(=O)c1ccccc1)C1(C(=O)c3ccccc3C1=O)N1CCC[C@@H]21.N1C(=O)[C@]2(c3ccccc13)[C@@H](C(=O)c1ccccc1)C1(C(=O)c3ccccc3C1=O)N1CCC[C@H]21 |
| Title of publication |
2'-Benzoyl-1',2,2',3,4',5',6',6a'-octahydro-1<i>H</i>-indan-2-spiro-3'-(3'<i>H</i>-pyrrolizine)-1'-spiro-3''-1<i>H</i>-indoline-1,2'',3-trione |
| Authors of publication |
P. R. Seshadri; S. Selvanayagam; D. Velmurugan; K. Ravikumar; A. R. Sureshbabu; R. Raghunathan |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2003 |
| Journal volume |
59 |
| Journal issue |
10 |
| Pages of publication |
o1559 - o1561 |
| a |
13.1419 ± 0.001 Å |
| b |
12.5844 ± 0.0009 Å |
| c |
14.011 ± 0.0011 Å |
| α |
90° |
| β |
100.601 ± 0.002° |
| γ |
90° |
| Cell volume |
2277.6 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0926 |
| Residual factor for significantly intense reflections |
0.0599 |
| Weighted residual factors for significantly intense reflections |
0.1505 |
| Weighted residual factors for all reflections included in the refinement |
0.1709 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.007 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2202380.html